For research use only. Not for therapeutic Use.
1,4-Naphthalenedicarboxylic acid is an aromatic dicarboxylic acid featuring carboxyl groups at the 1 and 4 positions of a naphthalene ring. This compound is significant in organic synthesis, particularly in the production of polymers, resins, and plasticizers. It serves as a building block in the synthesis of various functional materials, including dyes and pharmaceuticals. Its two carboxylic acid functionalities allow for versatile reactions, facilitating the formation of esters and amides, making it valuable in materials science and chemical research.
| CAS Number | 605-70-9 |
| Molecular Formula | C12H8O4 |
| Purity | ≥95% |
| IUPAC Name | naphthalene-1,4-dicarboxylic acid |
| InChI | InChI=1S/C12H8O4/c13-11(14)9-5-6-10(12(15)16)8-4-2-1-3-7(8)9/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | ABMFBCRYHDZLRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |