For research use only. Not for therapeutic Use.
1,4-DPCA ethyl ester（Cat No.:I044679）is a prodrug form of 1,4-dihydrophenonthrolin-4-one-3-carboxylic acid (1,4-DPCA), a selective inhibitor of prolyl hydroxylase domain (PHD) enzymes. By inhibiting PHDs, it stabilizes hypoxia-inducible factor-1 alpha (HIF-1α), promoting transcription of genes involved in angiogenesis, wound healing, and tissue regeneration. The ethyl ester modification enhances cell permeability and bioavailability, making it suitable for therapeutic applications. 1,4-DPCA ethyl ester has shown promise in regenerative medicine and ischemic disease models by enhancing vascularization, reducing inflammation, and promoting tissue repair through controlled HIF-1α activation under normoxic conditions.
| CAS Number | 86443-19-8 |
| Synonyms | ethyl 4-oxo-1H-1,10-phenanthroline-3-carboxylate |
| Molecular Formula | C15H12N2O3 |
| Purity | ≥95% |
| IUPAC Name | ethyl 4-oxo-1H-1,10-phenanthroline-3-carboxylate |
| InChI | InChI=1S/C15H12N2O3/c1-2-20-15(19)11-8-17-13-10(14(11)18)6-5-9-4-3-7-16-12(9)13/h3-8H,2H2,1H3,(H,17,18) |
| InChIKey | YUPWGIFULUYTQG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC3=C2N=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
