For research use only. Not for therapeutic Use.
1,4-Dichlorobenzene (Cat No.:R019833) is an aromatic compound featuring two chlorine atoms substituted at the para positions of a benzene ring. It is widely used as a moth repellent, deodorizer, and intermediate in the synthesis of dyes, agrochemicals, and polymers. Known for its volatility and strong odor, 1,4-dichlorobenzene sublimates easily, making it effective in air-freshening products. In industrial applications, it serves as a precursor to polyphenylene sulfide (PPS) and other engineering plastics. Its chemical stability and solubility in organic solvents enhance its versatility in chemical processing.
| CAS Number | 106-46-7 |
| Synonyms | 1,4-dichlorobenzene |
| Molecular Formula | C6H4Cl2 |
| Purity | ≥95% |
| IUPAC Name | 1,4-dichlorobenzene |
| InChI | InChI=1S/C6H4Cl2/c7-5-1-2-6(8)4-3-5/h1-4H |
| InChIKey | OCJBOOLMMGQPQU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1Cl)Cl |
| Reference | [1]. M. Tschickardt. Dichlorobenzene isomers (1,2-dichlorobenzene, 1,3-dichlorobenzene and 1,4 dichlorobenzene). |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
