For research use only. Not for therapeutic Use.
1,4-Dibromo-2,3,5,6-tetraiodobenzene (Cat.No:L003987) is a vital chemical compound in organic synthesis. Its unique structure, featuring bromine and iodine atoms, imparts distinctive reactivity. This compound is employed as a key building block in the creation of specialized molecules with various industrial and research applications.
| CAS Number | 886759-09-7 |
| Molecular Formula | C6Br2I4 |
| Purity | ≥95% |
| IUPAC Name | 1,4-dibromo-2,3,5,6-tetraiodobenzene |
| InChI | InChI=1S/C6Br2I4/c7-1-3(9)5(11)2(8)6(12)4(1)10 |
| InChIKey | XPGHEGXNGYFMQF-UHFFFAOYSA-N |
| SMILES | C1(=C(C(=C(C(=C1I)I)Br)I)I)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
