For research use only. Not for therapeutic Use.
1,4-Diamino-2,3-dichloroanthraquinone(Cat No.:L011217)is a chlorinated anthraquinone derivative with amino groups at the 1 and 4 positions. This compound is widely used in the synthesis of dyes, pigments, and bioactive molecules, particularly in pharmaceutical research. Its structure, featuring both chloro and amino substituents, allows for diverse chemical modifications, making it valuable in the development of anticancer agents and other therapeutic compounds. The compound’s vibrant color properties also make it useful in textile and material sciences. High purity ensures consistent performance in advanced research and industrial applications.
| CAS Number | 81-42-5 |
| Molecular Formula | C14H8Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1,4-diamino-2,3-dichloroanthracene-9,10-dione |
| InChI | InChI=1S/C14H8Cl2N2O2/c15-9-10(16)12(18)8-7(11(9)17)13(19)5-3-1-2-4-6(5)14(8)20/h1-4H,17-18H2 |
| InChIKey | KZYAYVSWIPZDKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C(=C3N)Cl)Cl)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |