For research use only. Not for therapeutic Use.
1,4-Di(bromomethyl)benzene(Cat No.:R050329)is an aromatic compound featuring a benzene ring substituted with two bromomethyl groups at the para (1,4) positions. This symmetrical molecule serves as a versatile building block in organic synthesis, particularly in the preparation of polymers, cross-linking agents, and macrocyclic compounds. The benzylic bromides are highly reactive in nucleophilic substitution and coupling reactions, enabling the formation of carbon–carbon or carbon–heteroatom bonds. It is often used in the synthesis of functional materials, ligands, and pharmaceuticals due to its structural rigidity and synthetic accessibility.
| CAS Number | 623-24-5 |
| Synonyms | 1,4-Bis(bromomethyl)benzene; 1,4-Xylylene Dibromide; 4-Bromomethylbenzyl Bromide; p-Xylylene Bromide; NSC 6226; |
| Molecular Formula | C8H8Br2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 1,4-bis(bromomethyl)benzene |
| InChI | InChI=1S/C8H8Br2/c9-5-7-1-2-8(6-10)4-3-7/h1-4H,5-6H2 |
| InChIKey | RBZMSGOBSOCYHR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CBr)CBr |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |