For research use only. Not for therapeutic Use.
1,4-Cyclohexanedicarboxylic acid(Cat No.:M069932), also known as CHDA, is a white crystalline solid used primarily in the production of polyesters, particularly in the synthesis of polybutylene terephthalate (PBT). Its molecular structure features a cyclohexane ring with two carboxylic acid groups located at the 1 and 4 positions. CHDA exhibits high thermal stability, making it valuable in various industrial applications, including engineering plastics, fibers, and coatings. Its unique chemical properties contribute to the enhancement of material strength, durability, and resistance to heat and chemicals, rendering it indispensable in the realm of polymer chemistry.
CAS Number | 1076-97-7 |
Molecular Formula | C8H12O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | cyclohexane-1,4-dicarboxylic acid |
InChI | InChI=1S/C8H12O4/c9-7(10)5-1-2-6(4-3-5)8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12) |
InChIKey | PXGZQGDTEZPERC-UHFFFAOYSA-N |
SMILES | C1CC(CCC1C(=O)O)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |