1,4-Bis(bromomethyl)-2,5-dimethylbenzene(Cat No.:L007145), is a chemical compound with the molecular formula C10H12Br2. It consists of a benzene ring substituted with two bromomethyl groups (-CH2Br) at the 1st and 4th positions and two methyl groups (-CH3) at the 2nd and 5th positions. This compound is significant in organic synthesis, particularly in the creation of polymers, resins, and specialty chemicals. Its unique structure and reactivity enable it to participate in various chemical reactions, making it valuable in the development of advanced materials and contributing to the progress of chemical research and industrial applications.
Catalog Number | L007145 |
CAS Number | 35168-62-8 |
Molecular Formula | C10H12Br2 |
Purity | ≥95% |
IUPAC Name | 1,4-bis(bromomethyl)-2,5-dimethylbenzene |
InChI | InChI=1S/C10H12Br2/c1-7-3-10(6-12)8(2)4-9(7)5-11/h3-4H,5-6H2,1-2H3 |
InChIKey | MUSYLRHTIZVVCB-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1CBr)C)CBr |