For research use only. Not for therapeutic Use.
1,4’-Bipiperidine（Cat No.:R019279）is a symmetrical, saturated heterocyclic compound consisting of two piperidine rings linked through their 1-positions. This rigid, nitrogen-containing structure makes it a valuable intermediate in pharmaceutical, agrochemical, and materials chemistry. It is commonly used in the synthesis of bioactive molecules, ligands for coordination complexes, and scaffolds in medicinal chemistry for drug discovery. The diamine functionality allows for versatile derivatization, including N-alkylation and acylation. 1,4’-Bipiperidine is especially useful in designing CNS-active agents and macrocyclic compounds where conformational control is essential for biological activity.
| CAS Number | 4897-50-1 |
| Synonyms | 4-(1-Piperidino)piperidine; |
| Molecular Formula | C10H20N2 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 1-piperidin-4-ylpiperidine |
| InChI | InChI=1S/C10H20N2/c1-2-8-12(9-3-1)10-4-6-11-7-5-10/h10-11H,1-9H2 |
| InChIKey | QDVBKXJMLILLLB-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2CCNCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
