1. Home
  2. Product
  3. Chemical Reagents
  4. Organic Building Blocks
  5. 1,3,6,8-Tetramethyl-9H-carbazole

1,3,6,8-Tetramethyl-9H-carbazole - CAS 6558-85-6

1,3,6,8-Tetramethyl-9H-carbazole (Cat.No:L004887) is a significant compound in organic synthesis and materials science. Known for its unique aromatic structure, this compound is widely used in the production of organic electronic materials, specifically in optoelectronic devices like OLEDs (Organic Light-Emitting Diodes). Its exceptional photophysical properties and stability make it a crucial component for the development of efficient light-emitting materials, highlighting its importance in contemporary research for innovative electronic applications.

Catalog Number: L004887

CAS Number: 6558-85-6

Molecular Formula: C16H17N

Molecular Weight:223.31

Purity: ≥95%

Online inquiry

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C16H17N
Molecular Weight223.31
Purity≥95%

Computed Descriptor

IUPAC Name1,3,6,8-tetramethyl-9H-carbazole
InChIInChI=1S/C16H17N/c1-9-5-11(3)15-13(7-9)14-8-10(2)6-12(4)16(14)17-15/h5-8,17H,1-4H3
InChIKeyKBGPFZUZKTUOII-UHFFFAOYSA-N
SMILESCC1=CC(=C2C(=C1)C3=CC(=CC(=C3N2)C)C)C