1,3,5,7-Tetrakis(4-formylphenyl)adamantane (Cat.No:L004035) is a pivotal compound in organic synthesis. Its unique adamantane core, adorned with formylphenyl groups, bestows distinctive reactivity. This compound serves as a valuable building block for the creation of specialized molecules with applications in pharmaceutical and materials research.
| Catalog Number | L004035 |
| CAS Number | 645401-15-6 |
| Molecular Formula | C38H32O4 |
| Purity | 95% |
| IUPAC Name | 4-[3,5,7-tris(4-formylphenyl)-1-adamantyl]benzaldehyde |
| InChI | InChI=1S/C38H32O4/c39-17-27-1-9-31(10-2-27)35-21-36(32-11-3-28(18-40)4-12-32)24-37(22-35,33-13-5-29(19-41)6-14-33)26-38(23-35,25-36)34-15-7-30(20-42)8-16-34/h1-20H,21-26H2 |
| InChIKey | KWZAZGHIMYCCIH-UHFFFAOYSA-N |
| SMILES | C1C2(CC3(CC1(CC(C2)(C3)C4=CC=C(C=C4)C=O)C5=CC=C(C=C5)C=O)C6=CC=C(C=C6)C=O)C7=CC=C(C=C7)C=O |
