For research use only. Not for therapeutic Use.
1,3,5-Tris[4-(dihydroxyboryl)phenyl]benzene (Cat.No:L003736) is a significant compound in materials science. Its unique structure incorporates boron-containing motifs, conferring distinct reactivity. This compound is employed as a crucial component in the synthesis of specialized materials, particularly in optoelectronic applications. Its versatile nature and applications underscore its value in the development of innovative materials for various industries, emphasizing its importance in the field of chemical synthesis and materials science.
CAS Number | 900795-73-5 |
Molecular Formula | C24H21B3O6 |
Purity | ≥95% |
IUPAC Name | [4-[3,5-bis(4-boronophenyl)phenyl]phenyl]boronic acid |
InChI | InChI=1S/C24H21B3O6/c28-25(29)22-7-1-16(2-8-22)19-13-20(17-3-9-23(10-4-17)26(30)31)15-21(14-19)18-5-11-24(12-6-18)27(32)33/h1-15,28-33H |
InChIKey | AKXLLRRTTCMCOZ-UHFFFAOYSA-N |
SMILES | B(C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=C(C=C3)B(O)O)C4=CC=C(C=C4)B(O)O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |