1,3,5-Tris(3-formylphenyl)benzene - CAS 1395348-26-1
1,3,5-Tris(3-formylphenyl)benzene (Cat.No:L004616) is a crucial compound in materials science. Its distinct structure, featuring three formylphenyl groups, imparts unique reactivity and properties. This compound serves as a valuable building block in the synthesis of specialized materials, particularly in the field of organic electronics.
Catalog Number: L004616
CAS Number: 1395348-26-1
Molecular Formula: C27H18O3
Molecular Weight:390.4
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
Molecular Formula: | C27H18O3 |
---|---|
Molecular Weight | 390.4 |
Purity | ≥95% |
Computed Descriptor
IUPAC Name | 3-[3,5-bis(3-formylphenyl)phenyl]benzaldehyde |
---|---|
InChI | InChI=1S/C27H18O3/c28-16-19-4-1-7-22(10-19)25-13-26(23-8-2-5-20(11-23)17-29)15-27(14-25)24-9-3-6-21(12-24)18-30/h1-18H |
InChIKey | JKEVWAQYDZUIMU-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C2=CC(=CC(=C2)C3=CC=CC(=C3)C=O)C4=CC=CC(=C4)C=O)C=O |