For research use only. Not for therapeutic Use.
1,3,5-trichloro-2-(chloromethyl)benzene (Cat. No.:M081096), also known as 2,4,6-Trichlorobenzoyl, is Nedanib impurity 79 and can be used for control analysis.
| CAS Number | 17293-03-7 |
| Molecular Formula | C7H4Cl4 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 1,3,5-trichloro-2-(chloromethyl)benzene |
| InChI | InChI=1S/C7H4Cl4/c8-3-5-6(10)1-4(9)2-7(5)11/h1-2H,3H2 |
| InChIKey | NJQRKFOZZUIMGW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)CCl)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
