For research use only. Not for therapeutic Use.
13,21-Dihydroeurycomanone（Cat No.:I044802）is a quassinoid compound isolated from the roots of Eurycoma longifolia, commonly known as Tongkat Ali. It is a reduced derivative of eurycomanone and shares similar pharmacological properties. This bioactive molecule is known for its potential androgenic, antimalarial, and anticancer effects. Studies suggest it may support testosterone production, enhance male fertility, and exhibit cytotoxic activity against various cancer cell lines. Additionally, it has been explored for its anti-inflammatory and antipyretic actions. Due to its therapeutic potential, 13,21-dihydroeurycomanone is of interest in natural product and pharmaceutical research.
| CAS Number | 129587-06-0 |
| Synonyms | (1R,4R,5R,6S,7R,8R,11R,13S,17S,18S,19R)-4,5,7,8,17-pentahydroxy-6,14,18-trimethyl-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione |
| Molecular Formula | C20H26O9 |
| Purity | ≥95% |
| IUPAC Name | (1R,4R,5R,6S,7R,8R,11R,13S,17S,18S,19R)-4,5,7,8,17-pentahydroxy-6,14,18-trimethyl-3,10-dioxapentacyclo[9.8.0.01,7.04,19.013,18]nonadec-14-ene-9,16-dione |
| InChI | InChI=1S/C20H26O9/c1-7-4-10(21)13(23)17(3)9(7)5-11-18-6-28-20(27,16(17)18)12(22)8(2)19(18,26)14(24)15(25)29-11/h4,8-9,11-14,16,22-24,26-27H,5-6H2,1-3H3/t8-,9-,11+,12+,13+,14-,16+,17+,18+,19-,20-/m0/s1 |
| InChIKey | PKICXNXDFYYYGH-QWRBDCSPSA-N |
| SMILES | C[C@H]1[C@H]([C@]2([C@@H]3[C@@]4([C@@H](C[C@@H]5[C@]3([C@]1([C@H](C(=O)O5)O)O)CO2)C(=CC(=O)[C@H]4O)C)C)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
