For research use only. Not for therapeutic Use.
13(S)-HpOTrE (13(S)-Hydroperoxyoctadecatrienoic Acid)(CAT: R067301) is a bioactive lipid derived from alpha-linolenic acid (ALA), an omega-3 fatty acid. It is formed through the enzymatic action of lipoxygenase, which introduces a hydroperoxide group at the 13th carbon position of ALA. 13(S)-HpOTrE is a precursor to various signaling molecules involved in inflammation, immune responses, and the regulation of oxidative stress. This compound is of particular interest in the study of plant and human physiology, where it plays a role in the formation of oxylipins—compounds that mediate defense mechanisms in plants and contribute to inflammatory resolution in humans. In medical research, 13(S)-HpOTrE is explored for its potential effects on cardiovascular health, inflammation, and its broader implications in metabolic and immune disorders.
| CAS Number | 67597-26-6 |
| Synonyms | 13S-hydroperoxy-9Z,11E,15Z-octadecatrienoic acid |
| Molecular Formula | C18H30O4 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | (9Z,11E,13S,15Z)-13-hydroperoxyoctadeca-9,11,15-trienoic acid |
| InChI | InChI=1S/C18H30O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h3,7,9,11-12,15,17,21H,2,4-6,8,10,13-14,16H2,1H3,(H,19,20)/b9-7-,11-3-,15-12+/t17-/m0/s1 |
| InChIKey | UYQGVDXDXBAABN-FQSPHKRJSA-N |
| SMILES | CCC=CCC(C=CC=CCCCCCCCC(=O)O)OO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |