For research use only. Not for therapeutic Use.
13-Hydroxytridecanoic acid(CAT: L000480) is a compound of interest in the field of organic chemistry, particularly as a key intermediate in the synthesis of various organic molecules. This compound finds applications in different fields, including the synthesis of lipids, surfactants, and other organic compounds used in various industries.
| CAS Number | 7735-38-8 |
| Molecular Formula | C13H26O3 |
| Purity | ≥95% |
| IUPAC Name | 13-hydroxytridecanoic acid |
| InChI | InChI=1S/C13H26O3/c14-12-10-8-6-4-2-1-3-5-7-9-11-13(15)16/h14H,1-12H2,(H,15,16) |
| InChIKey | DWXOPJCPYKBNEC-UHFFFAOYSA-N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
