For research use only. Not for therapeutic Use.
13-Hydroperoxylinolenic acid(Cat No.:M080320) is a fatty acid derivative and an important intermediate in the biosynthesis of jasmonates, which are signaling molecules in plants. This compound originates from linolenic acid, an essential polyunsaturated fatty acid. It features a hydroperoxide group at the 13th carbon of the linolenic acid chain, making it highly reactive. 13-Hydroperoxylinolenic acid plays a crucial role in plant defense mechanisms and stress responses, including pathogen defense and wound healing. Its production is often initiated by enzymatic action in response to physical damage or infection, highlighting its significance in plant biology and biochemistry.
| CAS Number | 19356-22-0 |
| Molecular Formula | C18H30O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (9Z,12Z,15Z)-octadeca-9,12,15-trieneperoxoic acid |
| InChI | InChI=1S/C18H30O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)21-20/h3-4,6-7,9-10,20H,2,5,8,11-17H2,1H3/b4-3-,7-6-,10-9- |
| InChIKey | OEYKGJFTEBHJCL-PDBXOOCHSA-N |
| SMILES | CCC=CCC=CCC=CCCCCCCCC(=O)OO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |