For research use only. Not for therapeutic Use.
1,3-Dimethylbutyl acetate(Cat No.:M069890) is a chemical compound with the molecular formula C8H16O2. It belongs to the class of esters and is commonly used as a fragrance ingredient in various consumer products such as perfumes, cosmetics, and personal care items. This colorless liquid has a fruity odor and is known for its pleasant scent, often described as sweet and floral. Due to its volatile nature, it evaporates easily, making it suitable for use in aerosol sprays, air fresheners, and other scented products where a long-lasting fragrance is desired.
CAS Number | 108-84-9 |
Molecular Formula | C8H16O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 4-methylpentan-2-yl acetate |
InChI | InChI=1S/C8H16O2/c1-6(2)5-7(3)10-8(4)9/h6-7H,5H2,1-4H3 |
InChIKey | CPIVYSAVIPTCCX-UHFFFAOYSA-N |
SMILES | CC(C)CC(C)OC(=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |