For research use only. Not for therapeutic Use.
1,3-Dimethyl-5-nitroadamantane (Cat No.:R033206) is a chemical compound. It is a derivative of adamantane, featuring two methyl groups and a nitro group (-NO2) attached to the carbon framework. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. The presence of the adamantane structure imparts specific steric and electronic properties, affecting its reactivity and potential applications.
| CAS Number | 6588-68-7 |
| Synonyms | 1,3-Dimethyl-5-nitroadamantane; |
| Molecular Formula | C12H19NO2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 1,3-dimethyl-5-nitroadamantane |
| InChI | InChI=1S/C12H19NO2/c1-10-3-9-4-11(2,6-10)8-12(5-9,7-10)13(14)15/h9H,3-8H2,1-2H3 |
| InChIKey | FUZZFPVZJGQAKD-UHFFFAOYSA-N |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)[N+](=O)[O-])C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |