For research use only. Not for therapeutic Use.
1,3-Dimethyl-1H-pyrazol-4-ol(Cat No.:L031866)is a pyrazole derivative characterized by the presence of two methyl groups and a hydroxyl group on the pyrazole ring. This structure is particularly important in medicinal chemistry due to its potential pharmacological properties. The pyrazole core is known for its role in creating compounds with anti-inflammatory, analgesic, and antipyretic activities. The hydroxyl group increases solubility and provides a site for further chemical modifications, enhancing the compound’s versatility in synthesizing more complex derivatives. 1,3-Dimethyl-1H-pyrazol-4-ol is widely used in the development of new drugs and biochemical research.
CAS Number | 85985-66-6 |
Molecular Formula | C5H8N2O |
Purity | ≥95% |
IUPAC Name | 1,3-dimethylpyrazol-4-ol |
InChI | InChI=1S/C5H8N2O/c1-4-5(8)3-7(2)6-4/h3,8H,1-2H3 |
InChIKey | XVUBEOHZTPQLCM-UHFFFAOYSA-N |
SMILES | CC1=NN(C=C1O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |