For research use only. Not for therapeutic Use.
(1,3-Dimethyl-1H-indazol-6-yl)boronic acid(Cat No.:L007271), is a valuable compound in the realm of organic and medicinal chemistry. As a boronic acid derivative, it holds significance in Suzuki-Miyaura cross-coupling reactions, a fundamental methodology in organic synthesis for creating carbon-carbon bonds. This compound acts as a key component in the construction of various biaryl structures, which are prevalent motifs in numerous pharmaceuticals and organic materials. Researchers utilize it to synthesize diverse organic compounds, including potential drug candidates and advanced materials for various applications. Its versatility makes it a pivotal reagent in modern organic synthesis endeavors.
| CAS Number | 1310405-37-8 |
| Molecular Formula | C9H11BN2O2 |
| Purity | ≥95% |
| Storage | 2-8°C |
| IUPAC Name | (1,3-dimethylindazol-6-yl)boronic acid |
| InChI | InChI=1S/C9H11BN2O2/c1-6-8-4-3-7(10(13)14)5-9(8)12(2)11-6/h3-5,13-14H,1-2H3 |
| InChIKey | FOUSXGGKIFZVIQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)C(=NN2C)C)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |