For research use only. Not for therapeutic Use.
1,3-Dibromo-5-chlorobenzene (Cat No.: R014548) is a halogenated aromatic compound featuring a benzene ring substituted with bromine atoms at the 1 and 3 positions and a chlorine atom at the 5 position. This compound is used as an intermediate in organic synthesis, particularly in the preparation of pharmaceuticals, agrochemicals, and advanced materials. The presence of multiple halogens enhances its reactivity in cross-coupling reactions such as Suzuki or Heck reactions. Its electron-withdrawing substituents also influence regioselectivity in electrophilic aromatic substitution reactions.
| CAS Number | 14862-52-3 |
| Synonyms | 3,5-Dibromochlorobenzene |
| Molecular Formula | C6H3Br2Cl |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1,3-dibromo-5-chlorobenzene |
| InChI | InChI=1S/C6H3Br2Cl/c7-4-1-5(8)3-6(9)2-4/h1-3H |
| InChIKey | FNKCOUREFBNNHG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Br)Br)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
