For research use only. Not for therapeutic Use.
1,3-Bis[3-(dimethylamino)propyl]urea(Cat No.:L040049)is a bifunctional urea derivative featuring two dimethylaminopropyl side chains. This compound is commonly used as a crosslinking agent, intermediate, or curing component in the synthesis of polymers, resins, and adhesives. Its dual amine functionality allows it to interact with various reactive groups, enhancing flexibility, durability, and adhesion in final materials. It is particularly useful in epoxy formulations and polyurethane systems. Additionally, its basic dimethylamino groups can participate in acid-base reactions, making it valuable in specialty chemical applications and fine chemical synthesis.
| CAS Number | 52338-87-1 |
| Molecular Formula | C11H26N4O |
| Purity | ≥95% |
| IUPAC Name | 1,3-bis[3-(dimethylamino)propyl]urea |
| InChI | InChI=1S/C11H26N4O/c1-14(2)9-5-7-12-11(16)13-8-6-10-15(3)4/h5-10H2,1-4H3,(H2,12,13,16) |
| InChIKey | FCQPNTOQFPJCMF-UHFFFAOYSA-N |
| SMILES | CN(C)CCCNC(=O)NCCCN(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |