For research use only. Not for therapeutic Use.
1,3-Bis(4-methoxyphenyl)propan-1-one(CAT: M285269) is an organic compound featuring a ketone functional group flanked by two 4-methoxyphenyl rings. The presence of methoxy groups on each phenyl ring enhances its stability and lipophilicity, making it useful as an intermediate in the synthesis of pharmaceuticals and fine chemicals. This structure is commonly employed in medicinal chemistry as a precursor for synthesizing various bioactive molecules, such as anti-inflammatory agents, enzyme inhibitors, and receptor modulators. Additionally, the ketone group allows for further functionalization, offering flexibility for developing compounds with tailored pharmacological properties.
| CAS Number | 20615-47-8 |
| Molecular Formula | C17H18O3 |
| Purity | ≥95% |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)propan-1-one |
| InChI | InChI=1S/C17H18O3/c1-19-15-8-3-13(4-9-15)5-12-17(18)14-6-10-16(20-2)11-7-14/h3-4,6-11H,5,12H2,1-2H3 |
| InChIKey | RBUUTPKKWGVWCJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CCC(=O)C2=CC=C(C=C2)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |