For research use only. Not for therapeutic Use.
1,27-Diphenyl-2,5,8,11,14,17,20,23,26-nonaoxaheptacosane is a polyether compound with a long chain featuring nine oxygen atoms spaced within a 27-carbon backbone, capped by phenyl groups at the 1- and 27-positions. This structure’s polyether linkages provide flexibility and solubility, making it useful in host-guest chemistry, supramolecular chemistry, and materials science. It often serves as a crown ether analog, facilitating studies in molecular recognition, ion transport, and catalysis, and is valuable for developing new materials with selective binding properties for ions or small molecules.
CAS Number | 105891-54-1 |
Molecular Formula | C30H46O9 |
Purity | ≥95% |
IUPAC Name | 2-[2-[2-[2-[2-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxymethylbenzene |
InChI | InChI=1S/C30H46O9/c1-3-7-29(8-4-1)27-38-25-23-36-21-19-34-17-15-32-13-11-31-12-14-33-16-18-35-20-22-37-24-26-39-28-30-9-5-2-6-10-30/h1-10H,11-28H2 |
InChIKey | SENSDOKALMLHTH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COCCOCCOCCOCCOCCOCCOCCOCCOCC2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |