For research use only. Not for therapeutic Use.
1,2,4,5-Tetramethylbenzene-3,6-d2 is a deuterated aromatic compound essential for advanced chemical and pharmaceutical research. This isotopically labeled version, with two deuterium atoms, is crucial for studying reaction mechanisms, metabolic pathways, and compound interactions. It offers enhanced stability and precise analytical results due to its stable isotope labeling. Ideal for synthetic chemistry and material science, 1,2,4,5-Tetramethylbenzene-3,6-d2 integrates seamlessly into existing protocols, providing a robust and cost-effective solution for high-precision scientific investigations. Optimize your research accuracy with this reliable deuterated compound.
CAS Number | 1859-01-4 |
Synonyms | 1,2,4,5-TETRAMETHYLBENZENE-3,6-D2 |
Molecular Formula | C10H14 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,4-dideuterio-2,3,5,6-tetramethylbenzene |
InChI | InChI=1S/C10H14/c1-7-5-9(3)10(4)6-8(7)2/h5-6H,1-4H3/i5D,6D |
InChIKey | SQNZJJAZBFDUTD-KCZCTXNHSA-N |
SMILES | CC1=CC(=C(C=C1C)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |