For research use only. Not for therapeutic Use.
1,2,4-Trivinylcyclohexane(Cat No.:M015346) is a synthetic organic compound characterized by its three vinyl groups attached to a cyclohexane ring. This unique structure makes it highly reactive and useful as a monomer in the polymerization process to produce new types of polymeric materials. The presence of multiple vinyl groups allows for cross-linking, which can lead to polymers with enhanced mechanical, thermal, and chemical resistance properties. This compound is particularly valuable in the development of specialty plastics and resins that require high performance under stress and in diverse environmental conditions. Its applications span automotive, aerospace, and electronics industries.
CAS Number | 2855-27-8 |
Synonyms | 1,2,4-TRIVINYLCYCLOHEXANE;TVCH;1,2,4-triethenyl-Cyclohexane;1,2,4-trivinylcyclohexane,mixtureofisomers;Cyclohexane, 1,2,4-trivinyl-;cyclohexane-1,2,4-triyltris(ethylene);1,2,4-TRIVINYLCYCLOHEXANE, 98%, MIXTURE OF ISOMERS;1,2,4-Trivinylcyclohexan |
Molecular Formula | C12H18 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,4-tris(ethenyl)cyclohexane |
InChI | InChI=1S/C12H18/c1-4-10-7-8-11(5-2)12(6-3)9-10/h4-6,10-12H,1-3,7-9H2 |
InChIKey | KTRQRAQRHBLCSQ-UHFFFAOYSA-N |
SMILES | C=CC1CCC(C(C1)C=C)C=C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |