For research use only. Not for therapeutic Use.
1,2,3,4,5,6,7,8-Octahydroanthracene(Cat No.:M067494), also known as octahydroanthracene or simply OHA, is a cyclic hydrocarbon with the molecular formula C14H18. It is derived from anthracene by the saturation of all eight carbon-carbon double bonds, resulting in a fully saturated ring structure. Octahydroanthracene appears as a colorless liquid with a faint aromatic odor. It is primarily used as a hydrogenation catalyst in organic synthesis, particularly in the production of cyclohexane and other cyclic compounds. Additionally, it serves as a precursor in the synthesis of various chemicals and pharmaceutical intermediates.
CAS Number | 1079-71-6 |
Molecular Formula | C14H18 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,3,4,5,6,7,8-octahydroanthracene |
InChI | InChI=1S/C14H18/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h9-10H,1-8H2 |
InChIKey | LFAYMJXHGYUQNV-UHFFFAOYSA-N |
SMILES | C1CCC2=CC3=C(CCCC3)C=C2C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |