For research use only. Not for therapeutic Use.
1,2,3-Trichloro-5-methylbenzene (Cat No.:C001075) is a chemical compound with three chlorine atoms and one methyl group attached to a benzene ring. It is a colorless liquid that is mainly used as an intermediate in the synthesis of various chemicals, including pharmaceuticals, agrochemicals, and other organic compounds. This compound is of interest in chemical research due to its unique substitution pattern, which can lead to the formation of different derivatives with varied properties.
CAS Number | 21472-86-6 |
Synonyms | 3,4,5-Trichlorotoluene; |
Molecular Formula | C₇H₅Cl₃ |
Purity | ≥95% |
Solubility | Chloroform (Sparingly), Methanol (Slightly) |
Appearance | White to Off-White Solid |
Storage | 4°C |
IUPAC Name | 1,2,3-trichloro-5-methylbenzene |
InChI | InChI=1S/C7H5Cl3/c1-4-2-5(8)7(10)6(9)3-4/h2-3H,1H3 |
InChIKey | DYBIAGHGODIVSM-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1)Cl)Cl)Cl |
Reference | Jain, N., et al.: J. Pharm. Sci., 88, 852-860 (1999) |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |