1,2-Propanediol(CAT: R022211) is a versatile chemical compound widely employed in pharmaceutical, organic chemistry, and material science. In the pharmaceutical field, it is commonly used as a solvent and excipient in drug formulations, aiding in the solubilization of poorly water-soluble drugs and improving drug delivery systems. In organic chemistry, it serves as a valuable reagent and starting material for the synthesis of various organic compounds.
Catalog Number | R022211 |
CAS Number | 57-55-6 |
Synonyms | (RS)-1,2-Propanediol; (±)-1,2-Propanediol; (±)-Propylene glycol; 1,2-(RS)-Propanediol; 1,2-Dihydroxypropane; 1,2-Propylene glycol; 1000PG; 2,3-Propanediol; 2-Hydroxypropanol; Adeka PG; Adeka Propylene Glycol PG-P; DC 403; DL-1,2-Propanediol; Dowfrost |
Molecular Formula | C3H8O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | propane-1,2-diol |
InChI | InChI=1S/C3H8O2/c1-3(5)2-4/h3-5H,2H2,1H3 |
InChIKey | DNIAPMSPPWPWGF-UHFFFAOYSA-N |
SMILES | CC(CO)O |