For research use only. Not for therapeutic Use.
1,2-Octanediol (Cat No.: R018477) is a linear aliphatic diol with eight carbon atoms and hydroxyl groups on the first and second carbon positions. It appears as a colorless to pale yellow liquid and is known for its antimicrobial and moisturizing properties. Commonly used in cosmetics and personal care products, it functions as a skin-conditioning agent, preservative booster, and emulsifier. Its amphiphilic nature enables it to interact with both hydrophilic and lipophilic substances, enhancing product stability and effectiveness in formulations like creams, lotions, and cleansers.
| CAS Number | 1117-86-8 |
| Synonyms | (±)-Octane-1,2-diol; 1,2-Dihydroxyoctane; 1,2-Octylene Glycol; 7,8-Dihydroxyoctane; Caprylyl Glycol; Dermosoft Octiol; LexGard O; NSC 71546; Sodiol ON; n-Octane-1,2-Diol |
| Molecular Formula | C8H18O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | octane-1,2-diol |
| InChI | InChI=1S/C8H18O2/c1-2-3-4-5-6-8(10)7-9/h8-10H,2-7H2,1H3 |
| InChIKey | AEIJTFQOBWATKX-UHFFFAOYSA-N |
| SMILES | CCCCCCC(CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |