For research use only. Not for therapeutic Use.
1,2-Hexanediol is an organic compound. It is a colorless, viscous liquid used primarily as a humectant, emollient, and preservative in cosmetics and personal care products. Additionally, it serves as a solvent and intermediate in the synthesis of various chemical products. Its antimicrobial properties make it valuable in formulations requiring enhanced shelf life and stability.
Catalog Number | R018478 |
CAS Number | 6920-22-5 |
Synonyms | (±)-Hexane-1,2-diol; 1,2-Dihydroxyhexane; 1,2-Hexyleneglycol; 5,6-Dihydroxyhexane; DL-1,2-Hexanediol; KMO 6 |
Molecular Formula | C6H14O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | hexane-1,2-diol |
InChI | InChI=1S/C6H14O2/c1-2-3-4-6(8)5-7/h6-8H,2-5H2,1H3 |
InChIKey | FHKSXSQHXQEMOK-UHFFFAOYSA-N |
SMILES | CCCCC(CO)O |