For research use only. Not for therapeutic Use.
1,2-Di(thiophen-2-yl)ethane-1,2-dione(CAT: L017852) is a high-purity, sulfur-containing heterocyclic compound featuring two thiophen-2-yl groups linked to a central ethane-1,2-dione (α-diketone) moiety. This molecule serves as a critical intermediate in organic synthesis and material science, particularly for the development of conjugated systems, functionalized polymers, and optoelectronic materials. The presence of the diketone group allows for selective nucleophilic additions and cyclization reactions, facilitating the synthesis of complex heterocycles and bioactive compounds. 1,2-Di(thiophen-2-yl)ethane-1,2-dione offers excellent stability and reactivity, making it an essential building block for medicinal chemistry, advanced material design, and organic electronic applications.
| CAS Number | 7333-07-5 |
| Molecular Formula | C10H6O2S2 |
| Purity | ≥95% |
| IUPAC Name | 1,2-dithiophen-2-ylethane-1,2-dione |
| InChI | InChI=1S/C10H6O2S2/c11-9(7-3-1-5-13-7)10(12)8-4-2-6-14-8/h1-6H |
| InChIKey | UNWKVSDABPCZMK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)C(=O)C2=CC=CS2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |