For research use only. Not for therapeutic Use.
1,2-Distearoyl-sn-glycerol(Cat No.:R027239)is a diacylglycerol (DAG) molecule composed of a glycerol backbone esterified with two stearic acid (saturated C18:0) chains at the sn-1 and sn-2 positions. As a biologically relevant lipid intermediate, it plays a critical role in lipid metabolism, membrane structure, and intracellular signaling. It serves as a precursor for the synthesis of triglycerides and phospholipids and can also activate protein kinase C (PKC), influencing pathways involved in cell growth, differentiation, and apoptosis. 1,2-Distearoyl-sn-glycerol is widely used in biochemical and lipidomics research to study lipid-mediated cellular processes.
CAS Number | 10567-21-2 |
Synonyms | [(2S)-3-hydroxy-2-octadecanoyloxypropyl] octadecanoate |
Molecular Formula | C39H76O5 |
Purity | ≥95% |
IUPAC Name | [(2S)-3-hydroxy-2-octadecanoyloxypropyl] octadecanoate |
InChI | InChI=1S/C39H76O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-38(41)43-36-37(35-40)44-39(42)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h37,40H,3-36H2,1-2H3/t37-/m0/s1 |
InChIKey | UHUSDOQQWJGJQS-QNGWXLTQSA-N |
SMILES | CCCCCCCCCCCCCCCCCC(=O)OC[C@H](CO)OC(=O)CCCCCCCCCCCCCCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |