For research use only. Not for therapeutic Use.
1,2-Diphenylpyrazolidine-3,5-dione(Cat No.:L020559)is a high-purity heterocyclic compound commonly used in pharmaceutical and chemical research. This molecule features a pyrazolidine ring with two phenyl groups at the 1 and 2 positions and carbonyl groups at the 3 and 5 positions, making it a versatile intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its unique structure allows for selective reactivity in various chemical transformations. 1,2-Diphenylpyrazolidine-3,5-dione is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research.
CAS Number | 2652-77-9 |
Molecular Formula | C15H12N2O2 |
Purity | ≥95% |
IUPAC Name | 1,2-diphenylpyrazolidine-3,5-dione |
InChI | InChI=1S/C15H12N2O2/c18-14-11-15(19)17(13-9-5-2-6-10-13)16(14)12-7-3-1-4-8-12/h1-10H,11H2 |
InChIKey | XDPKQGKEOCYMQC-UHFFFAOYSA-N |
SMILES | C1C(=O)N(N(C1=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |