For research use only. Not for therapeutic Use.
1,2-Diphenylbenzimidazole(CAT: L023330) is a high-purity aromatic heterocyclic compound widely utilized in pharmaceutical and chemical research. Featuring a benzimidazole core substituted with phenyl groups at the 1- and 2-positions, it serves as a versatile intermediate in the synthesis of bioactive molecules, dyes, and advanced materials. Its rigid aromatic structure and chemical stability make it suitable for diverse applications, including photophysical studies and drug discovery. With consistent performance and adaptability to various synthetic pathways, 1,2-Diphenylbenzimidazole supports innovative research in medicinal chemistry and material science.
CAS Number | 2622-67-5 |
Molecular Formula | C19H14N2 |
Purity | ≥95% |
IUPAC Name | 1,2-diphenylbenzimidazole |
InChI | InChI=1S/C19H14N2/c1-3-9-15(10-4-1)19-20-17-13-7-8-14-18(17)21(19)16-11-5-2-6-12-16/h1-14H |
InChIKey | ZLGVZKQXZYQJSM-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC3=CC=CC=C3N2C4=CC=CC=C4 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |