1,2-<wbr></wbr>Dioleyloxy-<wbr></wbr>3-<wbr></wbr>dimethylamino-<wbr></wbr>propane is a cationic lipid containing the unsaturated long-<wbr></wbr>chain (18:1) oleic acid inserted at both the <em>sn</em>-<wbr></wbr>1 and <em>sn</em>-<wbr></wbr>2 positions. It has been used in the composition of lipospomes formulated as stable nucleic acid lipid particles that can encapsulate siRNA or other small molecules to be used for drug delivery.
Catalog Number | R064976 |
CAS Number | 104162-47-2 |
Synonyms | DODMA;MBN 305A |
Molecular Formula | C41H81NO2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | N,N-dimethyl-2,3-bis(octadec-9-enoxy)propan-1-amine |
InChI | InChI=1S/C41H81NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43-40-41(39-42(3)4)44-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h19-22,41H,5-18,23-40H2,1-4H3 |
InChIKey | GLGLUQVVDHRLQK-UHFFFAOYSA-N |
SMILES | CCCCCCCCC=CCCCCCCCCOCC(CN(C)C)OCCCCCCCCC=CCCCCCCCC |
Reference | 1.Fenske, D.B.,Chonn, A., and Cullis, P.R. Liposomal nanomedicines: An emerging field. Toxicologic Pathology 36(1), 21-29 (2008). |