For research use only. Not for therapeutic Use.
1,2-Difluoro-4-iodo-3-methylbenzene(Cat No.:L022130)is a halogenated aromatic compound featuring two fluorine atoms, an iodine atom, and a methyl group on a benzene ring. This compound is commonly used in pharmaceutical research and organic synthesis as a building block for creating complex molecules, including drug candidates and specialty chemicals. Its structure offers versatile reactivity, particularly in cross-coupling reactions and halogen substitutions. Researchers in medicinal chemistry utilize this compound to explore innovative pathways in drug discovery and the development of new materials with specific functional properties.
CAS Number | 1208078-20-9 |
Molecular Formula | C7H5F2I |
Purity | ≥95% |
IUPAC Name | 1,2-difluoro-4-iodo-3-methylbenzene |
InChI | InChI=1S/C7H5F2I/c1-4-6(10)3-2-5(8)7(4)9/h2-3H,1H3 |
InChIKey | NSHADJULSPNJIX-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1F)F)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |