For research use only. Not for therapeutic Use.
12-(4-Nitrophenoxy)dodecanoic acid(Cat No.:L018429)is an organic compound featuring a long-chain dodecanoic acid (lauric acid) backbone with a 4-nitrophenoxy group attached at the terminal (12th) carbon. The molecule combines hydrophobic and aromatic characteristics, making it useful in surfactant development, membrane interaction studies, and drug delivery research. The nitrophenyl moiety introduces electron-withdrawing and UV-active properties, allowing for spectroscopic tracking or further chemical derivatization. Its amphiphilic nature enables applications in bioconjugation, materials science, and the synthesis of functionalized lipids, where controlled hydrophobic-hydrophilic balance is critical for self-assembly and biological activity.
CAS Number | 230613-81-7 |
Molecular Formula | C18H27NO5 |
Purity | ≥95% |
IUPAC Name | 12-(4-nitrophenoxy)dodecanoic acid |
InChI | InChI=1S/C18H27NO5/c20-18(21)10-8-6-4-2-1-3-5-7-9-15-24-17-13-11-16(12-14-17)19(22)23/h11-14H,1-10,15H2,(H,20,21) |
InChIKey | SVQZCSVOBTWEFB-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCCCCCCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |