For research use only. Not for therapeutic Use.
<span style="font-size:12px;"><span style="font-family:arial,helvetica,sans-serif;">11β-Prostaglandin E<sub>1</sub> (11β-PGE<sub>1</sub>) (CAS 24570-01-2) is an epimerized form of PGE<sub>1</sub> at the C-11 position. 11β-PGE<sub>1</sub> is a less potent isomer of PGE<sub>1</sub>. It is 13% and 3.6% as potent as PGE<sub>1</sub> in contracting the rat uterus and guinea pig ileum, respectively.</span></span>
| CAS Number | 24570-01-2 |
| Synonyms | 11BETA-PROSTAGLANDIN E1;9-OXO-11BETA-15S-DIHYDROXY-PROST-13E-EN-1-OIC ACID;11β-Prostaglandin E1 |
| Molecular Formula | C20H34O5 |
| Purity | ≥95% |
| Target | GPCR/G Protein |
| Storage | -20°C |
| IUPAC Name | 7-[(1R,2R,3S)-3-hydroxy-2-[(E,3S)-3-hydroxyoct-1-enyl]-5-oxocyclopentyl]heptanoic acid |
| InChI | InChI=1S/C20H34O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-17,19,21,23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,19-/m0/s1 |
| InChIKey | GMVPRGQOIOIIMI-FZYGRIMQSA-N |
| SMILES | CCCCCC(C=CC1C(CC(=O)C1CCCCCCC(=O)O)O)O |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |