For research use only. Not for therapeutic Use.
1,1,6-Trimethyltetralin is an organic compound featuring a tetralin core with three methyl groups attached at different positions. It is utilized in organic synthesis as a solvent and a starting material for the synthesis of various compounds. Its stable and inert nature makes it suitable for reactions requiring high temperatures or harsh conditions, contributing to its versatility in chemical processes.
CAS Number | 475-03-6 |
Synonyms | 1,2,3,4-Tetrahydro-1,1,6-trimethylnaphthalene; 1,1,6-Trimethyl-1,2,3,4-tetrahydronaphthalene |
Molecular Formula | C13H18 |
Purity | ≥95% |
Storage | -20℃ |
IUPAC Name | 4,4,7-trimethyl-2,3-dihydro-1H-naphthalene |
InChI | InChI=1S/C13H18/c1-10-6-7-12-11(9-10)5-4-8-13(12,2)3/h6-7,9H,4-5,8H2,1-3H3 |
InChIKey | LTMQZVLXCLQPCT-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1)C(CCC2)(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |