For research use only. Not for therapeutic Use.
1,1,1,2,3,4,4,5,5,5-Decafluoro-3-methoxy-2-(trifluoromethyl)pentane is a highly fluorinated organic compound characterized by a pentane backbone. It features ten fluorine atoms, a methoxy group (-OCH₃), and a trifluoromethyl group (-CF₃). Its chemical formula is C₈H₈F₁₃O. This compound is of interest in materials science and chemical synthesis due to its unique properties related to fluorination, such as stability and hydrophobicity. It may find applications in various fields, including pharmaceuticals, agrochemicals, and specialty chemicals.
CAS Number | 132182-92-4 |
Molecular Formula | C7H3F13O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1,1,1,2,2,3,4,5,5,5-decafluoro-3-methoxy-4-(trifluoromethyl)pentane |
InChI | InChI=1S/C7H3F13O/c1-21-4(11,3(9,10)7(18,19)20)2(8,5(12,13)14)6(15,16)17/h1H3 |
InChIKey | QKAGYSDHEJITFV-UHFFFAOYSA-N |
SMILES | COC(C(C(F)(F)F)(C(F)(F)F)F)(C(C(F)(F)F)(F)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |