For research use only. Not for therapeutic Use.
1,1-Dimethyl-1H-inden-2(3H)-one(CAT: L002624) is a high-purity bicyclic compound featuring a dimethyl-substituted indene core with a ketone functional group. This versatile molecule is widely utilized in pharmaceutical and chemical research as a building block for synthesizing complex organic compounds and bioactive molecules. Its unique structure and reactivity make it valuable for medicinal chemistry applications, including the development of novel therapeutic agents and functional materials. With consistent quality and excellent stability, 1,1-Dimethyl-1H-inden-2(3H)-one supports advanced research in drug discovery, organic synthesis, and material science.
| CAS Number | 38634-65-0 |
| Molecular Formula | C11H12O |
| Purity | ≥95% |
| IUPAC Name | 3,3-dimethyl-1H-inden-2-one |
| InChI | InChI=1S/C11H12O/c1-11(2)9-6-4-3-5-8(9)7-10(11)12/h3-6H,7H2,1-2H3 |
| InChIKey | GUHBZTMKWQVBLU-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)CC2=CC=CC=C21)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |