1,1-Diethoxyethene - CAS 2678-54-8

1,1-Diethoxyethene (Cat No.:M144158) is a chemical compound. It features two ethoxy (–OCH2CH3) groups connected by a double bond in the ethene backbone. This compound is important in organic synthesis and chemical research due to its potential applications in various reactions. Diethoxyethene can be utilized as a reagent in the preparation of various organic compounds. The presence of double bonds and ethoxy groups adds specific reactivity and functional diversity to the compound. 1,1-Diethoxyethene’s role as a versatile reagent contributes to its use in various laboratory and industrial processes, supporting scientific exploration and practical applications.

Catalog Number: M144158

CAS Number: 2678-54-8

PubChem Substance ID:355063241

Molecular Formula: C6H12O2

Molecular Weight:116.16

Purity: ≥95%

* For research use only. Not for human or veterinary use.

Synonym

Synonyms1,1-diethoxyethylene; Ethene, 1,1-diethoxy-; Ketene diethylacetal; Ketene diethyl acetal

Property

Molecular Formula: C6H12O2
Molecular Weight116.16
Purity≥95%
Storage2-8°C

Computed Descriptor

IUPAC Name1,1-diethoxyethene
InChIInChI=1S/C6H12O2/c1-4-7-6(3)8-5-2/h3-5H2,1-2H3
InChIKeyVTGIVYVOVVQLRL-UHFFFAOYSA-N
SMILESCCOC(=C)OCC