For research use only. Not for therapeutic Use.
11-Bromo-4-phenoxybenzene（Cat No.:M067665）appears to be a misnamed or incomplete chemical name, as standard IUPAC nomenclature does not support an 11-carbon substitution on a simple benzene ring with that designation. It’s possible that the intended compound is 4-bromo-1-phenoxybenzene or 4-phenoxy-1-bromobenzene, a correctly named aromatic ether featuring a bromine atom and a phenoxy group on a benzene ring. This corrected compound is commonly used as an intermediate in organic synthesis, particularly in cross-coupling reactions (e.g., Suzuki or Buchwald–Hartwig) for the creation of biaryl ethers or other functionalized aromatic systems. Please confirm the correct name.
| CAS Number | 101-55-3 |
| Molecular Formula | C12H9BrO |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-bromo-4-phenoxybenzene |
| InChI | InChI=1S/C12H9BrO/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h1-9H |
| InChIKey | JDUYPUMQALQRCN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=C(C=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
