For research use only. Not for therapeutic Use.
1,1-Bis(diphenylphosphino)ethylene is a bidentate phosphine ligand featuring an ethylene backbone with two diphenylphosphino groups. This compound is significant in organometallic chemistry and catalysis, particularly in asymmetric synthesis and cross-coupling reactions. Its unique structure provides strong chelation to transition metals, enhancing catalytic efficiency and selectivity. The presence of bulky diphenyl groups offers steric protection, making it valuable for stabilizing metal complexes. This ligand is widely used in the development of novel catalysts for various chemical transformations in synthetic chemistry.
| CAS Number | 84494-89-3 |
| Molecular Formula | C26H22P2 |
| Purity | ≥95% |
| IUPAC Name | 1-diphenylphosphanylethenyl(diphenyl)phosphane |
| InChI | InChI=1S/C26H22P2/c1-22(27(23-14-6-2-7-15-23)24-16-8-3-9-17-24)28(25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21H,1H2 |
| InChIKey | GEGLBMPXRFOXTK-UHFFFAOYSA-N |
| SMILES | C=C(P(C1=CC=CC=C1)C2=CC=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |