For research use only. Not for therapeutic Use.
1,1-Bis(hydroxymethyl)cyclopropane(Cat No.:R041474)is a cyclopropane derivative featuring two hydroxymethyl groups attached to the same carbon atom. This bifunctional compound appears as a white crystalline solid and is valued in organic synthesis for its strained three-membered ring and reactive hydroxyl groups. It serves as a versatile intermediate in the preparation of pharmaceuticals, agrochemicals, and specialty polymers. The hydroxymethyl groups allow for further chemical modification, such as esterification or etherification. Its rigid structure can impart unique conformational properties to target molecules, making it useful in structure-activity relationship studies and material design.
CAS Number | 39590-81-3 |
Synonyms | 1,1-Cyclopropanedimethanol; 1,1-Di(hydroxymethyl)cyclopropane; 2,2-(1,2-Ethylene)-1,3-propanediol; Cyclopropane-1,1-bis(methanol); |
Molecular Formula | C5H10O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | [1-(hydroxymethyl)cyclopropyl]methanol |
InChI | InChI=1S/C5H10O2/c6-3-5(4-7)1-2-5/h6-7H,1-4H2 |
InChIKey | YAINYZJQSQEGND-UHFFFAOYSA-N |
SMILES | C1CC1(CO)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |