For research use only. Not for therapeutic Use.
[1,1′-Bicyclohexyl]-4-carboxylic acid, 4′-propyl-, 4-fluorophenyl ester(Cat No.:L045095)is an organic compound used in pharmaceutical research and organic synthesis. The molecule features a bicyclohexyl core with a carboxylic acid group esterified with a 4-fluorophenyl group and a propyl chain at the 4′-position. This structure offers unique reactivity, making it valuable as an intermediate in the synthesis of complex molecules, particularly in the development of drugs and fine chemicals. Its combination of functional groups allows for diverse chemical modifications, making it essential for researchers focused on drug discovery and medicinal chemistry.
CAS Number | 81701-13-5 |
Molecular Formula | C22H31FO2 |
Purity | ≥95% |
IUPAC Name | (4-fluorophenyl) 4-(4-propylcyclohexyl)cyclohexane-1-carboxylate |
InChI | InChI=1S/C22H31FO2/c1-2-3-16-4-6-17(7-5-16)18-8-10-19(11-9-18)22(24)25-21-14-12-20(23)13-15-21/h12-19H,2-11H2,1H3 |
InChIKey | LIALNGUAWCANCX-UHFFFAOYSA-N |
SMILES | CCCC1CCC(CC1)C2CCC(CC2)C(=O)OC3=CC=C(C=C3)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |