For research use only. Not for therapeutic Use.
1,1′-(Azodicarbonyl)dipiperidine（Cat No.:M053756）is a yellow to orange crystalline compound composed of two piperidine rings linked by an azodicarbonyl (-N=N(C=O)₂-) group. It functions as a versatile azo-based reagent and is commonly used as a blowing agent in the production of foamed plastics, where it decomposes to release gases upon heating. Additionally, it serves as an oxidizing agent and nitrene source in organic synthesis, facilitating transformations such as aziridination and C–H amination. Due to its energetic properties and decomposition profile, it is handled with caution under controlled laboratory and industrial conditions.
| CAS Number | 10465-81-3 |
| Molecular Formula | C12H20N4O2 |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | N-(piperidine-1-carbonylimino)piperidine-1-carboxamide |
| InChI | InChI=1S/C12H20N4O2/c17-11(15-7-3-1-4-8-15)13-14-12(18)16-9-5-2-6-10-16/h1-10H2 |
| InChIKey | OQJBFFCUFALWQL-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)N=NC(=O)N2CCCCC2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
